Products Description
Tetrabutyl titanate is a water-white to light yellow liquid with an alcohol-like odor. It has a density similar to water and a flash point of 170°F. Direct contact maleic-anhydride.html">may lead to irritation or chemical burns on skin and mucous membranes.
Chemical Properties
| Item | Value |
| Melting point | -55°C |
| Boiling point | 206 °C/10 mmHg (lit.) |
| density | 1.00 g/mL at 20 °C (lit.) |
| vapor pressure | 5.6 hPa (20 °C) |
| refractive index | n20/D 1.491(lit.) |
| Fp | 55 °F |
| storage temp. | Store at +2°C to +8°C |
| solubility | Miscible with aliphatic, aromatic, chlorinated and oxygenated solvents |
| form | Liquid |
| color | Pale yellow |
| Specific Gravity | 0.998 |
| explosive limit | 2.0-12.0%(V) |
| Water Solubility | RAPIDLY HYDROLIZED |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 4148236 |
| Stability | Stable, but moisture sensitive. Flammable. Incompatible with water, moisture, strong oxidizing agents, strong acids |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/4C4H9O.Ti/c41-2-3-4-5;/h42-4H2,1H3;/q4*-1;+4 |
| InChIKey | YHWCPXVTRSHPNY-UHFFFAOYSA-N |
| SMILES | CCCCO[Ti](OCCCC)(OCCCC)OCCCC |
| LogP | 0.84 at 25℃ |
| CAS DataBase Reference | 5593-70-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Tetrabutoxytitanium(5593-70-4) |
| EPA Substance Registry System | Tetrabutyl titanate (5593-70-4) |
Safety Information
| Item | Value |
| Hazard Codes | Xi,T |
| Risk Statements | 10-36/37/38-67-41-37/38-45 |
| Safety Statements | 16-26-39-24/25-53 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 1 |
| RTECS | XR1585000 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29051900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1; Flam. Liq. 3; Skin Irrit. 2; STOT SE 3 |
| Hazardous Substances Data | 5593-70-4(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 3122 mg/kg |
Product Application
Tetrabutyl titanate is widely used in the preparation of anatase-phase nano-titania powders and ferroelectric bismuth titanate thin films. It acts as a chemical intermediate, paint additive, coating additive, processing aid, and process control agent. It is also applied in room-temperature synthesis of nanocrystalline titanium dioxide powders.
Supply & Delivery
Fast delivery time
Inventory: 2-3 working days
New production: 7-10 working days
